* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-7797 |
| English Synonyms: | ABBYPHARMA AP-10-7797 |
| MDL Number.: | MFCD16989155 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | OC(=O)C1=C(O)OC=N1 |
| InChi: | InChI=1S/C4H3NO4/c6-3(7)2-4(8)9-1-5-2/h1,8H,(H,6,7) |
| InChiKey: | InChIKey=JVBBGPOVQWIMLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.