* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-7856 |
| English Synonyms: | ABBYPHARMA AP-10-7856 |
| MDL Number.: | MFCD16989210 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1=C(N=C(O1)C(F)(F)F)C(N)=O |
| InChi: | InChI=1S/C6H5F3N2O2/c1-2-3(4(10)12)11-5(13-2)6(7,8)9/h1H3,(H2,10,12) |
| InChiKey: | InChIKey=WATGVIYBTPFXEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.