* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-7887 |
| English Synonyms: | ABBYPHARMA AP-10-7887 |
| MDL Number.: | MFCD16989241 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC1=C(CO)N=C(O1)C(O)=O |
| InChi: | InChI=1S/C6H7NO4/c1-3-4(2-8)7-5(11-3)6(9)10/h8H,2H2,1H3,(H,9,10) |
| InChiKey: | InChIKey=FPUHDOKOILSJLG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.