* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-10-7907 |
English Synonyms: | ABBYPHARMA AP-10-7907 |
MDL Number.: | MFCD16989259 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC1=C(N=C(O1)C(N)=O)C(N)=O |
InChi: | InChI=1S/C6H7N3O3/c1-2-3(4(7)10)9-6(12-2)5(8)11/h1H3,(H2,7,10)(H2,8,11) |
InChiKey: | InChIKey=UDVHFWJEGBNFMQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.