* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-10-7916 |
English Synonyms: | ABBYPHARMA AP-10-7916 |
MDL Number.: | MFCD16989268 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1=C(N=C(Cl)O1)C(N)=O |
InChi: | InChI=1S/C5H5ClN2O2/c1-2-3(4(7)9)8-5(6)10-2/h1H3,(H2,7,9) |
InChiKey: | InChIKey=PEZOFKSRHHAPBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.