* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABLOCK AB-14-2504 |
English Synonyms: | ABLOCK AB-14-2504 |
MDL Number.: | MFCD16989323 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c(nc(o1)N)Cl |
InChi: | InChI=1S/C3H3ClN2O/c4-2-1-7-3(5)6-2/h1H,(H2,5,6) |
InChiKey: | InChIKey=QVRQBHFYBFQSKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.