* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-7995 |
English Synonyms: | ABBYPHARMA AP-10-7995 |
MDL Number.: | MFCD16989338 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | OC1=COC(C=O)=N1 |
InChi: | InChI=1S/C4H3NO3/c6-1-4-5-3(7)2-8-4/h1-2,7H |
InChiKey: | InChIKey=NEUGRHUZEXMTLN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.