* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-7012 |
| English Synonyms: | ABBYPHARMA AP-11-7012 |
| MDL Number.: | MFCD16989351 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | NC(=O)C1=COC(CCl)=N1 |
| InChi: | InChI=1S/C5H5ClN2O2/c6-1-4-8-3(2-10-4)5(7)9/h2H,1H2,(H2,7,9) |
| InChiKey: | InChIKey=YNLWOIJZUNZTFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.