* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-11-7015 |
English Synonyms: | ABBYPHARMA AP-11-7015 |
MDL Number.: | MFCD16989354 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC1=NC(N)=CO1 |
InChi: | InChI=1S/C5H8N2O2/c1-2-8-5-7-4(6)3-9-5/h3H,2,6H2,1H3 |
InChiKey: | InChIKey=POQUSAKXRDZJGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.