* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-11-7023 |
English Synonyms: | ABBYPHARMA AP-11-7023 |
MDL Number.: | MFCD16989362 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | ClCC1=COC(=N1)C#N |
InChi: | InChI=1S/C5H3ClN2O/c6-1-4-3-9-5(2-7)8-4/h3H,1H2 |
InChiKey: | InChIKey=BBZFUOXFPPYIRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.