* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-7024 |
| English Synonyms: | ABBYPHARMA AP-11-7024 |
| MDL Number.: | MFCD16989363 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | N#CC1=NC(=CO1)C#N |
| InChi: | InChI=1S/C5HN3O/c6-1-4-3-9-5(2-7)8-4/h3H |
| InChiKey: | InChIKey=VBPUACBVQWMOJJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.