* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-7029 |
| English Synonyms: | ABBYPHARMA AP-11-7029 |
| MDL Number.: | MFCD16989368 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | NC1=COC(=N1)C(O)=O |
| InChi: | InChI=1S/C4H4N2O3/c5-2-1-9-3(6-2)4(7)8/h1H,5H2,(H,7,8) |
| InChiKey: | InChIKey=JEUXORQZKQQKSD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.