* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-7031 |
| English Synonyms: | ABBYPHARMA AP-11-7031 |
| MDL Number.: | MFCD16989370 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | OC(=O)C1=NC(CCl)=CO1 |
| InChi: | InChI=1S/C5H4ClNO3/c6-1-3-2-10-4(7-3)5(8)9/h2H,1H2,(H,8,9) |
| InChiKey: | InChIKey=ODQSGDPUGVXRFQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.