* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-7037 |
| English Synonyms: | ABBYPHARMA AP-11-7037 |
| MDL Number.: | MFCD16989376 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | OCC1=NC(C=O)=CO1 |
| InChi: | InChI=1S/C5H5NO3/c7-1-4-3-9-5(2-8)6-4/h1,3,8H,2H2 |
| InChiKey: | InChIKey=JWLCEIBIBXETIA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.