* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7044 |
English Synonyms: | ABBYPHARMA AP-11-7044 |
MDL Number.: | MFCD16989383 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1=COC(=N1)C(N)=O |
InChi: | InChI=1S/C5H6N2O2/c1-3-2-9-5(7-3)4(6)8/h2H,1H3,(H2,6,8) |
InChiKey: | InChIKey=ZEEMQFFQICHHBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.