* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7101 |
English Synonyms: | ABBYPHARMA AP-11-7101 |
MDL Number.: | MFCD16989430 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | OCC1=C(OC(C=O)=N1)C#N |
InChi: | InChI=1S/C6H4N2O3/c7-1-5-4(2-9)8-6(3-10)11-5/h3,9H,2H2 |
InChiKey: | InChIKey=AKKLXOUIPYMMSV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.