* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7136 |
English Synonyms: | ABBYPHARMA AP-11-7136 |
MDL Number.: | MFCD16989463 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC1=NC(CO)=C(O1)C(O)=O |
InChi: | InChI=1S/C7H9NO5/c1-2-12-7-8-4(3-9)5(13-7)6(10)11/h9H,2-3H2,1H3,(H,10,11) |
InChiKey: | InChIKey=MLIMKHQGOMOHJE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.