* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7155 |
English Synonyms: | ABBYPHARMA AP-11-7155 |
MDL Number.: | MFCD16989482 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | NC(=O)C1=NC(CO)=C(O1)C=O |
InChi: | InChI=1S/C6H6N2O4/c7-5(11)6-8-3(1-9)4(2-10)12-6/h2,9H,1H2,(H2,7,11) |
InChiKey: | InChIKey=MSABGQLKLGQXJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.