* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7156 |
English Synonyms: | ABBYPHARMA AP-11-7156 |
MDL Number.: | MFCD16989483 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | NC(=O)C1=NC(CO)=C(N)O1 |
InChi: | InChI=1S/C5H7N3O3/c6-3(10)5-8-2(1-9)4(7)11-5/h9H,1,7H2,(H2,6,10) |
InChiKey: | InChIKey=HWVUMYLPOIUVRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.