* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-7211 |
| English Synonyms: | ABBYPHARMA AP-11-7211 |
| MDL Number.: | MFCD16989538 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | OCC1=NC(CO)=C(CO)O1 |
| InChi: | InChI=1S/C6H9NO4/c8-1-4-5(2-9)11-6(3-10)7-4/h8-10H,1-3H2 |
| InChiKey: | InChIKey=IUNJYSMNRFUAAN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.