* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7218 |
English Synonyms: | ABBYPHARMA AP-11-7218 |
MDL Number.: | MFCD16989545 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | NC(=O)C1=C(CO)N=CO1 |
InChi: | InChI=1S/C5H6N2O3/c6-5(9)4-3(1-8)7-2-10-4/h2,8H,1H2,(H2,6,9) |
InChiKey: | InChIKey=NPICNVFGDLOTCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.