* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7229 |
English Synonyms: | ABBYPHARMA AP-11-7229 |
MDL Number.: | MFCD16989556 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | OCC1=C(Br)OC(Br)=N1 |
InChi: | InChI=1S/C4H3Br2NO2/c5-3-2(1-8)7-4(6)9-3/h8H,1H2 |
InChiKey: | InChIKey=FSDQLDFQPBZBMH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.