* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7233 |
English Synonyms: | ABBYPHARMA AP-11-7233 |
MDL Number.: | MFCD16989560 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | NC(=O)C1=NC(CO)=C(O)O1 |
InChi: | InChI=1S/C5H6N2O4/c6-3(9)4-7-2(1-8)5(10)11-4/h8,10H,1H2,(H2,6,9) |
InChiKey: | InChIKey=IVILBUBJLIMXGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.