* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7243 |
English Synonyms: | ABBYPHARMA AP-11-7243 |
MDL Number.: | MFCD16989570 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | OCC1=C(O)OC(=N1)C#N |
InChi: | InChI=1S/C5H4N2O3/c6-1-4-7-3(2-8)5(9)10-4/h8-9H,2H2 |
InChiKey: | InChIKey=ATCNTTVWAOZRAA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.