* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7258 |
English Synonyms: | ABBYPHARMA AP-11-7258 |
MDL Number.: | MFCD16989584 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | NC1=NC(CCl)=C(O1)C(O)=O |
InChi: | InChI=1S/C5H5ClN2O3/c6-1-2-3(4(9)10)11-5(7)8-2/h1H2,(H2,7,8)(H,9,10) |
InChiKey: | InChIKey=VDIOWFUVXLGOEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.