* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7274 |
English Synonyms: | ABBYPHARMA AP-11-7274 |
MDL Number.: | MFCD16989600 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | ClCC1=NC(CCl)=C(O1)C=O |
InChi: | InChI=1S/C6H5Cl2NO2/c7-1-4-5(3-10)11-6(2-8)9-4/h3H,1-2H2 |
InChiKey: | InChIKey=YEXYVSBISIUYAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.