* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7552 |
English Synonyms: | ABBYPHARMA AP-11-7552 |
MDL Number.: | MFCD16989873 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | NC1=C(O)OC(C=O)=N1 |
InChi: | InChI=1S/C4H4N2O3/c5-3-4(8)9-2(1-7)6-3/h1,8H,5H2 |
InChiKey: | InChIKey=CQGVDDFUSACKOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.