* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7581 |
English Synonyms: | ABBYPHARMA AP-11-7581 |
MDL Number.: | MFCD16989902 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC1=C(N)N=C(O)O1 |
InChi: | InChI=1S/C4H6N2O2/c1-2-3(5)6-4(7)8-2/h5H2,1H3,(H,6,7) |
InChiKey: | InChIKey=GYGXPSHPYGASRI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.