* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7591 |
English Synonyms: | ABBYPHARMA AP-11-7591 |
MDL Number.: | MFCD16989912 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | NC(=O)C1=C(N)N=C(O)O1 |
InChi: | InChI=1S/C4H5N3O3/c5-2-1(3(6)8)10-4(9)7-2/h5H2,(H2,6,8)(H,7,9) |
InChiKey: | InChIKey=AURSIRCNNWLPGI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.