* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7592 |
English Synonyms: | ABBYPHARMA AP-11-7592 |
MDL Number.: | MFCD16989913 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | NC1=C(CO)OC(O)=N1 |
InChi: | InChI=1S/C4H6N2O3/c5-3-2(1-7)9-4(8)6-3/h7H,1,5H2,(H,6,8) |
InChiKey: | InChIKey=LZHPQYJGQZDFFU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.