* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7598 |
English Synonyms: | ABBYPHARMA AP-11-7598 |
MDL Number.: | MFCD16989919 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | NC1=COC(O)=N1 |
InChi: | InChI=1S/C3H4N2O2/c4-2-1-7-3(6)5-2/h1H,4H2,(H,5,6) |
InChiKey: | InChIKey=HGBRBTBMLVMYPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.