* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7600 |
English Synonyms: | ABBYPHARMA AP-11-7600 |
MDL Number.: | MFCD16989921 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | NC1=C(N)N=C(O1)C#N |
InChi: | InChI=1S/C4H4N4O/c5-1-2-8-3(6)4(7)9-2/h6-7H2 |
InChiKey: | InChIKey=CEMGLZUMVODLPS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.