* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7602 |
English Synonyms: | ABBYPHARMA AP-11-7602 |
MDL Number.: | MFCD16989923 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | NC1=C(CCl)OC(=N1)C#N |
InChi: | InChI=1S/C5H4ClN3O/c6-1-3-5(8)9-4(2-7)10-3/h1,8H2 |
InChiKey: | InChIKey=RXUDBICUZHSEPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.