* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABLOCK AB-14-4026 |
English Synonyms: | ABLOCK AB-14-4026 |
MDL Number.: | MFCD16989990 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1nc(c(o1)Br)N |
InChi: | InChI=1S/C3H3BrN2O/c4-2-3(5)6-1-7-2/h1H,5H2 |
InChiKey: | InChIKey=YXQZDNNBMOHRPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.