* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABBYPHARMA AP-11-7678 |
English Synonyms: | ABBYPHARMA AP-11-7678 |
MDL Number.: | MFCD16989999 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1=NC(C)=C(Cl)O1 |
InChi: | InChI=1S/C5H6ClNO/c1-3-5(6)8-4(2)7-3/h1-2H3 |
InChiKey: | InChIKey=WHAGTCBVVFPCNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.