* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7768 |
English Synonyms: | ABBYPHARMA AP-11-7768 |
MDL Number.: | MFCD16990079 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1=C(OC(=N1)C(N)=O)C#N |
InChi: | InChI=1S/C6H5N3O2/c1-3-4(2-7)11-6(9-3)5(8)10/h1H3,(H2,8,10) |
InChiKey: | InChIKey=SOKULIXMHXJIQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.