* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-11-7954 |
| English Synonyms: | ABBYPHARMA AP-11-7954 |
| MDL Number.: | MFCD16990233 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | BrC1=C(N=CO1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C9H6BrNO/c10-9-8(11-6-12-9)7-4-2-1-3-5-7/h1-6H |
| InChiKey: | InChIKey=AJSYUPQDOBPXGA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.