* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-PHENYL-1,3-OXAZOL-2-OL |
English Synonyms: | 4-PHENYL-1,3-OXAZOL-2-OL ; 4-PHENYL-OXAZOL-2-OL |
MDL Number.: | MFCD16990247 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2coc(n2)O |
InChi: | InChI=1S/C9H7NO2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-6H,(H,10,11) |
InChiKey: | InChIKey=FXJBHVJHXKVCQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.