* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-11-7977 |
English Synonyms: | ABBYPHARMA AP-11-7977 |
MDL Number.: | MFCD16990253 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOC1=NC(C=O)=C(O1)C=O |
InChi: | InChI=1S/C7H7NO4/c1-2-11-7-8-5(3-9)6(4-10)12-7/h3-4H,2H2,1H3 |
InChiKey: | InChIKey=PSOCVRQVTZNDFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.