* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-7025 |
English Synonyms: | ABBYPHARMA AP-12-7025 |
MDL Number.: | MFCD16990298 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | ClCC1=NC(C=O)=C(O1)C#N |
InChi: | InChI=1S/C6H3ClN2O2/c7-1-6-9-4(3-10)5(2-8)11-6/h3H,1H2 |
InChiKey: | InChIKey=DFAGZJOGTUGVPO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.