* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-7028 |
English Synonyms: | ABBYPHARMA AP-12-7028 |
MDL Number.: | MFCD16990301 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | OC(=O)C1=C(C=O)N=C(CCl)O1 |
InChi: | InChI=1S/C6H4ClNO4/c7-1-4-8-3(2-9)5(12-4)6(10)11/h2H,1H2,(H,10,11) |
InChiKey: | InChIKey=BQXHEBYWAAQIBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.