* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-7049 |
English Synonyms: | ABBYPHARMA AP-12-7049 |
MDL Number.: | MFCD16990322 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | OC(=O)C1=C(C=O)N=CO1 |
InChi: | InChI=1S/C5H3NO4/c7-1-3-4(5(8)9)10-2-6-3/h1-2H,(H,8,9) |
InChiKey: | InChIKey=AFWRUJCGDJTXRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.