* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-7067 |
English Synonyms: | ABBYPHARMA AP-12-7067 |
MDL Number.: | MFCD16990339 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | OCC1=C(C=O)N=C(CCl)O1 |
InChi: | InChI=1S/C6H6ClNO3/c7-1-6-8-4(2-9)5(3-10)11-6/h2,10H,1,3H2 |
InChiKey: | InChIKey=IWMWLVQCUNMFDG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.