* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-7077 |
English Synonyms: | ABBYPHARMA AP-12-7077 |
MDL Number.: | MFCD16990349 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | BrC1=C(C=O)N=C(O1)C=O |
InChi: | InChI=1S/C5H2BrNO3/c6-5-3(1-8)7-4(2-9)10-5/h1-2H |
InChiKey: | InChIKey=MNZGAGOFNDLIEP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.