* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-7085 |
English Synonyms: | ABBYPHARMA AP-12-7085 |
MDL Number.: | MFCD16990357 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | NC(=O)C1=NC(C=O)=C(Br)O1 |
InChi: | InChI=1S/C5H3BrN2O3/c6-3-2(1-9)8-5(11-3)4(7)10/h1H,(H2,7,10) |
InChiKey: | InChIKey=UHBPPEOVRWDJFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.