* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-12-7096 |
English Synonyms: | ABBYPHARMA AP-12-7096 |
MDL Number.: | MFCD16990368 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | OC(=O)C1=NC(C=O)=C(O)O1 |
InChi: | InChI=1S/C5H3NO5/c7-1-2-5(10)11-3(6-2)4(8)9/h1,10H,(H,8,9) |
InChiKey: | InChIKey=MFFQUNNIVVJWIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.