* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-13347 |
English Synonyms: | ABBYPHARMA AP-10-13347 |
MDL Number.: | MFCD16990604 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC1=NOC(=N1)[C@@H](N)CC1=CC2=CC=CC=C2N1 |
InChi: | InChI=1S/C13H14N4O/c1-8-15-13(18-17-8)11(14)7-10-6-9-4-2-3-5-12(9)16-10/h2-6,11,16H,7,14H2,1H3/t11-/m0/s1 |
InChiKey: | InChIKey=FZBCBEBUGPIDRR-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.