* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-13443 |
English Synonyms: | ABBYPHARMA AP-10-13443 |
MDL Number.: | MFCD16990608 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | OC(=O)C(O)=O.CNCC1=NC(=NO1)C1=CC=CC=C1 |
InChi: | InChI=1S/C10H11N3O.C2H2O4/c1-11-7-9-12-10(13-14-9)8-5-3-2-4-6-8;3-1(4)2(5)6/h2-6,11H,7H2,1H3;(H,3,4)(H,5,6) |
InChiKey: | InChIKey=NOTXXVJIDVEXQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.