* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-13445 |
English Synonyms: | ABBYPHARMA AP-10-13445 |
MDL Number.: | MFCD16990610 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | I.C1CC(CCN1)C1=NOC=N1 |
InChi: | InChI=1S/C7H11N3O.HI/c1-3-8-4-2-6(1)7-9-5-11-10-7;/h5-6,8H,1-4H2;1H |
InChiKey: | InChIKey=SQDZZRXMZPSOFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.