* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,7-DIFLUOROBICYCLO[4.1.0]HEPTAN-2-ONE |
| English Synonyms: | 7,7-DIFLUOROBICYCLO[4.1.0]HEPTAN-2-ONE |
| MDL Number.: | MFCD16990724 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C1CC2C(C2(F)F)C(=O)C1 |
| InChi: | InChI=1S/C7H8F2O/c8-7(9)4-2-1-3-5(10)6(4)7/h4,6H,1-3H2 |
| InChiKey: | InChIKey=ROGDHMVMJRRJEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.